About methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate
methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate (PubChem CID 163424896) has the molecular formula C7H15N5O4S
and a molecular weight of 265.30 g/mol. Its IUPAC name is methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate.
Molecular Properties
| Compound Name | methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate |
| PubChem CID | 163424896 |
| Molecular Formula | C7H15N5O4S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate |
| SMILES | C/N=C(/N/C(=N\C)NC(=O)NS(C)(=O)=O)OC |
| InChI | InChI=1S/C7H15N5O4S/c1-8-5(11-7(9-2)16-3)10-6(13)12-17(4,14)15/h1-4H3,(H3,8,9,10,11,12,13) |
| InChIKey | ALQAWRKBNHESLZ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate?
The IUPAC name of methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate (CID 163424896) is methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate.
What is the SMILES notation for methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate?
The canonical SMILES for methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate is C/N=C(/N/C(=N\C)NC(=O)NS(C)(=O)=O)OC.
What is the InChIKey of methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate?
The InChIKey is ALQAWRKBNHESLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5O4S/c1-8-5(11-7(9-2)16-3)10-6(13)12-17(4,14)15/h1-4H3,(H3,8,9,10,11,12,13).
What are the key properties of methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate?
methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate has a molecular weight of 265.30 g/mol, XLogP of -1.55, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-methyl-N-[N'-methyl-N-(methylsulfonylcarbamoyl)carbamimidoyl]carbamimidate is sourced from PubChem (CID 163424896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).