C19H31F3O3 — CID 163425313
(2S,3S,5S)-3-[(4R)-4-methoxypentyl]-2-methyl-5-[4-(trifluoromethoxy)cyclohexen-1-yl]oxane (PubChem CID 163425313) has the molecular formula C19H31F3O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (2S,3S,5S)-3-[(4R)-4-methoxypentyl]-2-methyl-5-[4-(trifluoromethoxy)cyclohexen-1-yl]oxane.
| Compound Name | (2S,3S,5S)-3-[(4R)-4-methoxypentyl]-2-methyl-5-[4-(trifluoromethoxy)cyclohexen-1-yl]oxane |
|---|---|
| PubChem CID | 163425313 |
| Molecular Formula | C19H31F3O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2S,3S,5S)-3-[(4R)-4-methoxypentyl]-2-methyl-5-[4-(trifluoromethoxy)cyclohexen-1-yl]oxane |
| SMILES | CO[C@H](C)CCC[C@H]1C[C@@H](C2=CCC(OC(F)(F)F)CC2)CO[C@H]1C |
| InChI | InChI=1S/C19H31F3O3/c1-13(23-3)5-4-6-16-11-17(12-24-14(16)2)15-7-9-18(10-8-15)25-19(20,21)22/h7,13-14,16-18H,4-6,8-12H2,1-3H3/t13-,14+,16+,17-,18?/m1/s1 |
| InChIKey | ALZDHTDTURZBEK-KIPYLHMVSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|