C43H25N3O2 — CID 163425897
2-(8-naphtho[1,2-b][1]benzofuran-9-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 163425897) has the molecular formula C43H25N3O2 and a molecular weight of 615.69 g/mol. Its IUPAC name is 2-(8-naphtho[1,2-b][1]benzofuran-9-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(8-naphtho[1,2-b][1]benzofuran-9-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163425897 |
| Molecular Formula | C43H25N3O2 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 2-(8-naphtho[1,2-b][1]benzofuran-9-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccc(-c5ccc6c(c5)oc5c7ccccc7ccc65)cc34)n2)cc1 |
| InChI | InChI=1S/C43H25N3O2/c1-3-10-27(11-4-1)41-44-42(28-12-5-2-6-13-28)46-43(45-41)31-17-20-34-36-23-29(18-22-37(36)47-38(34)25-31)30-16-19-33-35-21-15-26-9-7-8-14-32(26)40(35)48-39(33)24-30/h1-25H |
| InChIKey | KBTHKGAGISCYDE-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |