C8H12N2 — CID 163426329
4-methyl-2,3,4,5-tetrahydro-1H-benzimidazole (PubChem CID 163426329) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 4-methyl-2,3,4,5-tetrahydro-1H-benzimidazole.
| Compound Name | 4-methyl-2,3,4,5-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 163426329 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 4-methyl-2,3,4,5-tetrahydro-1H-benzimidazole |
| SMILES | CC1CC=CC2=C1NCN2 |
| InChI | InChI=1S/C8H12N2/c1-6-3-2-4-7-8(6)10-5-9-7/h2,4,6,9-10H,3,5H2,1H3 |
| InChIKey | AMVLFEFALTVNRI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |