C18H24O5 — CID 163426463
[(2R,3aS,5R,5aR,9aR)-3a-acetyloxy-5-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-2-yl] acetate (PubChem CID 163426463) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(2R,3aS,5R,5aR,9aR)-3a-acetyloxy-5-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-2-yl] acetate.
| Compound Name | [(2R,3aS,5R,5aR,9aR)-3a-acetyloxy-5-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 163426463 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(2R,3aS,5R,5aR,9aR)-3a-acetyloxy-5-prop-2-enyl-3,4,5,5a,6,9-hexahydro-2H-indeno[7a,1-b]furan-2-yl] acetate |
| SMILES | C=CC[C@@H]1C[C@]2(OC(C)=O)C[C@@H](OC(C)=O)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C18H24O5/c1-4-7-14-10-17(22-13(3)20)11-16(21-12(2)19)23-18(17)9-6-5-8-15(14)18/h4-6,14-16H,1,7-11H2,2-3H3/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | AMYFAHVLOLYHSJ-DFBDCSAJSA-N |
| XLogP | 2.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|