C19H11Cl2NO4 — CID 163426983
1,9-dichloro-8-oxido-8,14-dihydrochromeno[2,3-c]phenoxazin-8-ium-14-ol (PubChem CID 163426983) has the molecular formula C19H11Cl2NO4 and a molecular weight of 388.21 g/mol. Its IUPAC name is 1,9-dichloro-8-oxido-8,14-dihydrochromeno[2,3-c]phenoxazin-8-ium-14-ol.
| Compound Name | 1,9-dichloro-8-oxido-8,14-dihydrochromeno[2,3-c]phenoxazin-8-ium-14-ol |
|---|---|
| PubChem CID | 163426983 |
| Molecular Formula | C19H11Cl2NO4 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 1,9-dichloro-8-oxido-8,14-dihydrochromeno[2,3-c]phenoxazin-8-ium-14-ol |
| SMILES | [O-][NH+]1c2ccc3c(c2Oc2cccc(Cl)c21)C(O)c1c(Cl)cccc1O3 |
| InChI | InChI=1S/C19H11Cl2NO4/c20-9-3-1-5-12-15(9)18(23)16-13(25-12)8-7-11-19(16)26-14-6-2-4-10(21)17(14)22(11)24/h1-8,18,22-23H |
| InChIKey | ANJJGYYCCZLEFM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |