About 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol
1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol (PubChem CID 163427168) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol.
Molecular Properties
| Compound Name | 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol |
| PubChem CID | 163427168 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol |
| SMILES | Cc1cc(-c2cnco2)ccc1C(C)S |
| InChI | InChI=1S/C12H13NOS/c1-8-5-10(12-6-13-7-14-12)3-4-11(8)9(2)15/h3-7,9,15H,1-2H3 |
| InChIKey | ANMUNRAIUXOMEY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol?
The IUPAC name of 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol (CID 163427168) is 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol.
What is the SMILES notation for 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol?
The canonical SMILES for 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol is Cc1cc(-c2cnco2)ccc1C(C)S.
What is the InChIKey of 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol?
The InChIKey is ANMUNRAIUXOMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-8-5-10(12-6-13-7-14-12)3-4-11(8)9(2)15/h3-7,9,15H,1-2H3.
What are the key properties of 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol?
1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol has a molecular weight of 219.31 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methyl-4-(1,3-oxazol-5-yl)phenyl]ethanethiol is sourced from PubChem (CID 163427168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).