About 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine
6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine (PubChem CID 163428064) has the molecular formula C9H7ClF2N2O
and a molecular weight of 232.62 g/mol. Its IUPAC name is 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine |
| PubChem CID | 163428064 |
| Molecular Formula | C9H7ClF2N2O |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine |
| SMILES | FC(F)COc1cc2nccn2cc1Cl |
| InChI | InChI=1S/C9H7ClF2N2O/c10-6-4-14-2-1-13-9(14)3-7(6)15-5-8(11)12/h1-4,8H,5H2 |
| InChIKey | AOESJPQEICLHNH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine?
The IUPAC name of 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine (CID 163428064) is 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine?
The canonical SMILES for 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine is FC(F)COc1cc2nccn2cc1Cl.
What is the InChIKey of 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine?
The InChIKey is AOESJPQEICLHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF2N2O/c10-6-4-14-2-1-13-9(14)3-7(6)15-5-8(11)12/h1-4,8H,5H2.
What are the key properties of 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine?
6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine has a molecular weight of 232.62 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-(2,2-difluoroethoxy)imidazo[1,2-a]pyridine is sourced from PubChem (CID 163428064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).