C28H37FIN2O3- — CID 163428342
[4-[(1S)-3-[3-[[(1R)-1-(4-fluoro-2-hydroxyphenyl)ethyl]amino]iodanuidylpropyl]cyclopentyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 163428342) has the molecular formula C28H37FIN2O3- and a molecular weight of 595.52 g/mol. Its IUPAC name is [4-[(1S)-3-[3-[[(1R)-1-(4-fluoro-2-hydroxyphenyl)ethyl]amino]iodanuidylpropyl]cyclopentyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-[(1S)-3-[3-[[(1R)-1-(4-fluoro-2-hydroxyphenyl)ethyl]amino]iodanuidylpropyl]cyclopentyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 163428342 |
| Molecular Formula | C28H37FIN2O3- |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [4-[(1S)-3-[3-[[(1R)-1-(4-fluoro-2-hydroxyphenyl)ethyl]amino]iodanuidylpropyl]cyclopentyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | C[C@@H](N[I-]CCCC1CC[C@H](c2ccc(C(=O)N3CCC(O)CC3)cc2)C1)c1ccc(F)cc1O |
| InChI | InChI=1S/C28H37FIN2O3/c1-19(26-11-10-24(29)18-27(26)34)31-30-14-2-3-20-4-5-23(17-20)21-6-8-22(9-7-21)28(35)32-15-12-25(33)13-16-32/h6-11,18-20,23,25,31,33-34H,2-5,12-17H2,1H3/q-1/t19-,20?,23+/m1/s1 |
| InChIKey | XQSFCWHIKICADQ-HUJVSABWSA-N |
| XLogP | 2.15 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|