C19H19Cl2N3O2 — CID 163428886
5-cyclopropyl-N-[(3S)-1-[(2,4-dichlorophenyl)methyl]-4-methylidenepyrrolidin-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 163428886) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(3S)-1-[(2,4-dichlorophenyl)methyl]-4-methylidenepyrrolidin-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(3S)-1-[(2,4-dichlorophenyl)methyl]-4-methylidenepyrrolidin-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 163428886 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 5-cyclopropyl-N-[(3S)-1-[(2,4-dichlorophenyl)methyl]-4-methylidenepyrrolidin-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | C=C1CN(Cc2ccc(Cl)cc2Cl)C[C@H]1NC(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-11-8-24(9-13-4-5-14(20)6-15(13)21)10-17(11)22-19(25)16-7-18(26-23-16)12-2-3-12/h4-7,12,17H,1-3,8-10H2,(H,22,25)/t17-/m1/s1 |
| InChIKey | AOUKCUURGIQELN-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|