C25H37N5O6 — CID 163429155
tert-butyl (3R)-3-[[[(2S)-1-(phenylmethoxycarbamoyl)azepane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 163429155) has the molecular formula C25H37N5O6 and a molecular weight of 503.60 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[(2S)-1-(phenylmethoxycarbamoyl)azepane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[(2S)-1-(phenylmethoxycarbamoyl)azepane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163429155 |
| Molecular Formula | C25H37N5O6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | tert-butyl (3R)-3-[[[(2S)-1-(phenylmethoxycarbamoyl)azepane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(=O)NNC(=O)[C@@H]2CCCCCN2C(=O)NOCc2ccccc2)C1 |
| InChI | InChI=1S/C25H37N5O6/c1-25(2,3)36-24(34)29-15-13-19(16-29)21(31)26-27-22(32)20-12-8-5-9-14-30(20)23(33)28-35-17-18-10-6-4-7-11-18/h4,6-7,10-11,19-20H,5,8-9,12-17H2,1-3H3,(H,26,31)(H,27,32)(H,28,33)/t19-,20+/m1/s1 |
| InChIKey | AOZPJBIMRIFQDU-UXHICEINSA-N |
| XLogP | 2.48 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|