C25H29FO5 — CID 163429951
[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 163429951) has the molecular formula C25H29FO5 and a molecular weight of 428.50 g/mol. Its IUPAC name is [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163429951 |
| Molecular Formula | C25H29FO5 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](OC(=O)/C=C/c2ccc(F)cc2)/C=C/C(=O)O1 |
| InChI | InChI=1S/C25H29FO5/c1-17-5-3-2-4-6-19-15-21(27)16-22(19)23(12-14-24(28)30-17)31-25(29)13-9-18-7-10-20(26)11-8-18/h4,6-14,17,19,21-23,27H,2-3,5,15-16H2,1H3/b6-4+,13-9+,14-12+/t17-,19+,21-,22+,23+/m0/s1 |
| InChIKey | FMSIAFLIIAICGP-GLVSZSNOSA-N |
| XLogP | 4.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|