C22H19ClN4S — CID 163430651
8-(5-but-1-ynyl-2-chlorophenyl)-N-prop-1-en-2-yl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-amine (PubChem CID 163430651) has the molecular formula C22H19ClN4S and a molecular weight of 406.94 g/mol. Its IUPAC name is 8-(5-but-1-ynyl-2-chlorophenyl)-N-prop-1-en-2-yl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-amine.
| Compound Name | 8-(5-but-1-ynyl-2-chlorophenyl)-N-prop-1-en-2-yl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 163430651 |
| Molecular Formula | C22H19ClN4S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 8-(5-but-1-ynyl-2-chlorophenyl)-N-prop-1-en-2-yl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-amine |
| SMILES | C=C(C)Nc1nc2c(s1)-c1nc(-c3cc(C#CCC)ccc3Cl)ncc1CC2 |
| InChI | InChI=1S/C22H19ClN4S/c1-4-5-6-14-7-9-17(23)16(11-14)21-24-12-15-8-10-18-20(19(15)27-21)28-22(26-18)25-13(2)3/h7,9,11-12H,2,4,8,10H2,1,3H3,(H,25,26) |
| InChIKey | AQEROOIDSVNMRL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|