C11H25N3O2-2 — CID 163431704
N,N-bis[2-methylbutan-2-yl(oxido)amino]methanamine (PubChem CID 163431704) has the molecular formula C11H25N3O2-2 and a molecular weight of 231.34 g/mol. Its IUPAC name is N,N-bis[2-methylbutan-2-yl(oxido)amino]methanamine.
| Compound Name | N,N-bis[2-methylbutan-2-yl(oxido)amino]methanamine |
|---|---|
| PubChem CID | 163431704 |
| Molecular Formula | C11H25N3O2-2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N,N-bis[2-methylbutan-2-yl(oxido)amino]methanamine |
| SMILES | CCC(C)(C)N([O-])N(C)N([O-])C(C)(C)CC |
| InChI | InChI=1S/C11H25N3O2/c1-8-10(3,4)13(15)12(7)14(16)11(5,6)9-2/h8-9H2,1-7H3/q-2 |
| InChIKey | CYTUQYVWFRZBOB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|