About 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene
6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene (PubChem CID 163431710) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene.
Molecular Properties
| Compound Name | 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene |
| PubChem CID | 163431710 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene |
| SMILES | C=CC12C(C)=CCCC1=CC2C |
| InChI | InChI=1S/C12H16/c1-4-12-9(2)6-5-7-11(12)8-10(12)3/h4,6,8,10H,1,5,7H2,2-3H3 |
| InChIKey | ARAWJEMGFRINKS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene?
The IUPAC name of 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene (CID 163431710) is 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene.
What is the SMILES notation for 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene?
The canonical SMILES for 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene is C=CC12C(C)=CCCC1=CC2C.
What is the InChIKey of 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene?
The InChIKey is ARAWJEMGFRINKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-4-12-9(2)6-5-7-11(12)8-10(12)3/h4,6,8,10H,1,5,7H2,2-3H3.
What are the key properties of 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene?
6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene has a molecular weight of 160.26 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-5,7-dimethylbicyclo[4.2.0]octa-1(8),4-diene is sourced from PubChem (CID 163431710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).