About (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine
(3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine (PubChem CID 163432884) has the molecular formula C17H35N
and a molecular weight of 253.47 g/mol. Its IUPAC name is (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine.
Molecular Properties
| Compound Name | (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine |
| PubChem CID | 163432884 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine |
| SMILES | C=C(CCC)N[C@H](CC)CCC(CC)C(C)(C)C |
| InChI | InChI=1S/C17H35N/c1-8-11-14(4)18-16(10-3)13-12-15(9-2)17(5,6)7/h15-16,18H,4,8-13H2,1-3,5-7H3/t15?,16-/m1/s1 |
| InChIKey | ARZZPQUGNKDAEW-OEMAIJDKSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine?
The IUPAC name of (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine (CID 163432884) is (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine.
What is the SMILES notation for (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine?
The canonical SMILES for (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine is C=C(CCC)N[C@H](CC)CCC(CC)C(C)(C)C.
What is the InChIKey of (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine?
The InChIKey is ARZZPQUGNKDAEW-OEMAIJDKSA-N. The full InChI is InChI=1S/C17H35N/c1-8-11-14(4)18-16(10-3)13-12-15(9-2)17(5,6)7/h15-16,18H,4,8-13H2,1-3,5-7H3/t15?,16-/m1/s1.
What are the key properties of (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine?
(3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine has a molecular weight of 253.47 g/mol, XLogP of 5.52, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-ethyl-7,7-dimethyl-N-pent-1-en-2-yloctan-3-amine is sourced from PubChem (CID 163432884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).