C11H17FN2O2 — CID 163433069
methyl 2-(1,3-dimethylpyrazol-4-yl)-3-fluoropentanoate (PubChem CID 163433069) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is methyl 2-(1,3-dimethylpyrazol-4-yl)-3-fluoropentanoate.
| Compound Name | methyl 2-(1,3-dimethylpyrazol-4-yl)-3-fluoropentanoate |
|---|---|
| PubChem CID | 163433069 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | methyl 2-(1,3-dimethylpyrazol-4-yl)-3-fluoropentanoate |
| SMILES | CCC(F)C(C(=O)OC)c1cn(C)nc1C |
| InChI | InChI=1S/C11H17FN2O2/c1-5-9(12)10(11(15)16-4)8-6-14(3)13-7(8)2/h6,9-10H,5H2,1-4H3 |
| InChIKey | ASDSTNARIQAUGQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |