About 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol
3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol (PubChem CID 163433096) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol |
| PubChem CID | 163433096 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol |
| SMILES | CC1C(C(CN)CO)COC12C[C@H]2C |
| InChI | InChI=1S/C11H21NO2/c1-7-3-11(7)8(2)10(6-14-11)9(4-12)5-13/h7-10,13H,3-6,12H2,1-2H3/t7-,8?,9?,10?,11?/m1/s1 |
| InChIKey | ASEQJSHIHLVAJY-MKMHIBQSSA-N |
| XLogP | 0.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol?
The IUPAC name of 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol (CID 163433096) is 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol.
What is the SMILES notation for 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol?
The canonical SMILES for 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol is CC1C(C(CN)CO)COC12C[C@H]2C.
What is the InChIKey of 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol?
The InChIKey is ASEQJSHIHLVAJY-MKMHIBQSSA-N. The full InChI is InChI=1S/C11H21NO2/c1-7-3-11(7)8(2)10(6-14-11)9(4-12)5-13/h7-10,13H,3-6,12H2,1-2H3/t7-,8?,9?,10?,11?/m1/s1.
What are the key properties of 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol?
3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol has a molecular weight of 199.29 g/mol, XLogP of 0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[(2R)-2,7-dimethyl-4-oxaspiro[2.4]heptan-6-yl]propan-1-ol is sourced from PubChem (CID 163433096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).