C15H25NO2S2 — CID 163433574
3-(2-tert-butyl-2,4,4-trimethylpentanoyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 163433574) has the molecular formula C15H25NO2S2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 3-(2-tert-butyl-2,4,4-trimethylpentanoyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-tert-butyl-2,4,4-trimethylpentanoyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 163433574 |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-(2-tert-butyl-2,4,4-trimethylpentanoyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)CC(C)(C(=O)N1C(=O)CSC1=S)C(C)(C)C |
| InChI | InChI=1S/C15H25NO2S2/c1-13(2,3)9-15(7,14(4,5)6)11(18)16-10(17)8-20-12(16)19/h8-9H2,1-7H3 |
| InChIKey | ASNPVIDHHDWFPD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|