C21H34NO4+ — CID 163433936
[4-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 163433936) has the molecular formula C21H34NO4+ and a molecular weight of 364.51 g/mol. Its IUPAC name is [4-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 163433936 |
| Molecular Formula | C21H34NO4+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [4-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CC(C)(COCc1ccccc1)C(=O)OC1CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C21H33NO4/c1-19(2,15-25-14-16-10-8-7-9-11-16)18(23)26-17-12-20(3,4)22(24)21(5,6)13-17/h7-11,17,24H,12-15H2,1-6H3/p+1 |
| InChIKey | ASVYXLBZTFJMTK-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|