C22H27NO6 — CID 163434881
tert-butyl 1-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethyl]-2-oxo-1,3a,4,5,6,8b-hexahydroindeno[2,1-b]pyrrole-3-carboxylate (PubChem CID 163434881) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl 1-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethyl]-2-oxo-1,3a,4,5,6,8b-hexahydroindeno[2,1-b]pyrrole-3-carboxylate.
| Compound Name | tert-butyl 1-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethyl]-2-oxo-1,3a,4,5,6,8b-hexahydroindeno[2,1-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 163434881 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl 1-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethyl]-2-oxo-1,3a,4,5,6,8b-hexahydroindeno[2,1-b]pyrrole-3-carboxylate |
| SMILES | CC1=CC(OCC2C(=O)N(C(=O)OC(C)(C)C)C3CC4=C(C=CCC4)C23)OC1=O |
| InChI | InChI=1S/C22H27NO6/c1-12-9-17(28-20(12)25)27-11-15-18-14-8-6-5-7-13(14)10-16(18)23(19(15)24)21(26)29-22(2,3)4/h6,8-9,15-18H,5,7,10-11H2,1-4H3 |
| InChIKey | ATPUCEAQFNFBLJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |