C18H19N3OS — CID 163435159
2-[4-(morpholin-4-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 163435159) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-[4-(morpholin-4-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[4-(morpholin-4-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 163435159 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[4-(morpholin-4-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | Nc1ccnc2cc(-c3ccc(CN4CCOCC4)cc3)sc12 |
| InChI | InChI=1S/C18H19N3OS/c19-15-5-6-20-16-11-17(23-18(15)16)14-3-1-13(2-4-14)12-21-7-9-22-10-8-21/h1-6,11H,7-10,12H2,(H2,19,20) |
| InChIKey | ATWAVIOXVRMJGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |