C32H40N8O3 — CID 163435802
N-[5-[[(1S)-2-(dimethylamino)-1-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]carbamoyl]-1,6,6-trimethyl-4H-pyrrolo[3,4-d]pyrazol-3-yl]-7-(prop-2-enoylamino)indolizine-2-carboxamide (PubChem CID 163435802) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is N-[5-[[(1S)-2-(dimethylamino)-1-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]carbamoyl]-1,6,6-trimethyl-4H-pyrrolo[3,4-d]pyrazol-3-yl]-7-(prop-2-enoylamino)indolizine-2-carboxamide.
| Compound Name | N-[5-[[(1S)-2-(dimethylamino)-1-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]carbamoyl]-1,6,6-trimethyl-4H-pyrrolo[3,4-d]pyrazol-3-yl]-7-(prop-2-enoylamino)indolizine-2-carboxamide |
|---|---|
| PubChem CID | 163435802 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | N-[5-[[(1S)-2-(dimethylamino)-1-(1-methylcyclohexa-2,4-dien-1-yl)ethyl]carbamoyl]-1,6,6-trimethyl-4H-pyrrolo[3,4-d]pyrazol-3-yl]-7-(prop-2-enoylamino)indolizine-2-carboxamide |
| SMILES | C=CC(=O)Nc1ccn2cc(C(=O)Nc3nn(C)c4c3CN(C(=O)N[C@H](CN(C)C)C3(C)C=CC=CC3)C4(C)C)cc2c1 |
| InChI | InChI=1S/C32H40N8O3/c1-8-26(41)33-22-12-15-39-18-21(16-23(39)17-22)29(42)35-28-24-19-40(31(2,3)27(24)38(7)36-28)30(43)34-25(20-37(5)6)32(4)13-10-9-11-14-32/h8-13,15-18,25H,1,14,19-20H2,2-7H3,(H,33,41)(H,34,43)(H,35,36,42)/t25-,32?/m1/s1 |
| InChIKey | AUJOWFFGMZHHNZ-LYYPKXFYSA-N |
| XLogP | 4.26 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|