About 5-fluoro-3a-methyl-1,7a-dihydroindole
5-fluoro-3a-methyl-1,7a-dihydroindole (PubChem CID 163436495) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 5-fluoro-3a-methyl-1,7a-dihydroindole.
Molecular Properties
| Compound Name | 5-fluoro-3a-methyl-1,7a-dihydroindole |
| PubChem CID | 163436495 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 5-fluoro-3a-methyl-1,7a-dihydroindole |
| SMILES | CC12C=CNC1C=CC(F)=C2 |
| InChI | InChI=1S/C9H10FN/c1-9-4-5-11-8(9)3-2-7(10)6-9/h2-6,8,11H,1H3 |
| InChIKey | AUYBUBSFPBZEML-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3a-methyl-1,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3a-methyl-1,7a-dihydroindole?
The IUPAC name of 5-fluoro-3a-methyl-1,7a-dihydroindole (CID 163436495) is 5-fluoro-3a-methyl-1,7a-dihydroindole.
What is the SMILES notation for 5-fluoro-3a-methyl-1,7a-dihydroindole?
The canonical SMILES for 5-fluoro-3a-methyl-1,7a-dihydroindole is CC12C=CNC1C=CC(F)=C2.
What is the InChIKey of 5-fluoro-3a-methyl-1,7a-dihydroindole?
The InChIKey is AUYBUBSFPBZEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN/c1-9-4-5-11-8(9)3-2-7(10)6-9/h2-6,8,11H,1H3.
What are the key properties of 5-fluoro-3a-methyl-1,7a-dihydroindole?
5-fluoro-3a-methyl-1,7a-dihydroindole has a molecular weight of 151.18 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3a-methyl-1,7a-dihydroindole is sourced from PubChem (CID 163436495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).