About (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine
(6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine (PubChem CID 163436500) has the molecular formula C17H37NS
and a molecular weight of 287.56 g/mol. Its IUPAC name is (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine.
Molecular Properties
| Compound Name | (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine |
| PubChem CID | 163436500 |
| Molecular Formula | C17H37NS |
| Molecular Weight | 287.56 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine |
| SMILES | CCCN(C)CCCCC(CCCSC)[C@H](C)CC |
| InChI | InChI=1S/C17H37NS/c1-6-13-18(4)14-9-8-11-17(16(3)7-2)12-10-15-19-5/h16-17H,6-15H2,1-5H3/t16-,17?/m1/s1 |
| InChIKey | AUYFRSJGRCWXIC-TZHYSIJRSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine?
The IUPAC name of (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine (CID 163436500) is (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine.
What is the SMILES notation for (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine?
The canonical SMILES for (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine is CCCN(C)CCCCC(CCCSC)[C@H](C)CC.
What is the InChIKey of (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine?
The InChIKey is AUYFRSJGRCWXIC-TZHYSIJRSA-N. The full InChI is InChI=1S/C17H37NS/c1-6-13-18(4)14-9-8-11-17(16(3)7-2)12-10-15-19-5/h16-17H,6-15H2,1-5H3/t16-,17?/m1/s1.
What are the key properties of (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine?
(6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine has a molecular weight of 287.56 g/mol, XLogP of 5.30, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-N,6-dimethyl-5-(3-methylsulfanylpropyl)-N-propyloctan-1-amine is sourced from PubChem (CID 163436500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).