C52H41N4Si- — CID 163437043
[3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(6-methylcyclohexa-1,3-dien-1-yl)-diphenylsilanuide (PubChem CID 163437043) has the molecular formula C52H41N4Si- and a molecular weight of 750.01 g/mol. Its IUPAC name is [3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(6-methylcyclohexa-1,3-dien-1-yl)-diphenylsilanuide.
| Compound Name | [3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(6-methylcyclohexa-1,3-dien-1-yl)-diphenylsilanuide |
|---|---|
| PubChem CID | 163437043 |
| Molecular Formula | C52H41N4Si- |
| Molecular Weight | 750.01 g/mol |
| Exact Mass | 749.31 |
| IUPAC Name | [3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-(6-methylcyclohexa-1,3-dien-1-yl)-diphenylsilanuide |
| SMILES | CC1CC=CC=C1[SiH-](c1ccccc1)(c1ccccc1)c1cccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)n2)c1 |
| InChI | InChI=1S/C52H41N4Si/c1-37-19-11-16-34-49(37)57(42-25-7-3-8-26-42,43-27-9-4-10-28-43)44-29-18-23-40(36-44)52-54-50(38-20-5-2-6-21-38)53-51(55-52)39-22-17-24-41(35-39)56-47-32-14-12-30-45(47)46-31-13-15-33-48(46)56/h2-18,20-37,57H,19H2,1H3/q-1 |
| InChIKey | AVJUWTOFURZFLP-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.01 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|