C28H44N4O3 — CID 163437586
2-[(4-hydrazinyl-3-pyridinyl)amino]-1-[3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 163437586) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-3-pyridinyl)amino]-1-[3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-[(4-hydrazinyl-3-pyridinyl)amino]-1-[3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 163437586 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 2-[(4-hydrazinyl-3-pyridinyl)amino]-1-[3-hydroxy-3-(methoxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | COCC1(O)CCC2(C)C(CCC3C2CCC2(C)C(C(=O)CNc4cnccc4NN)CCC32)C1 |
| InChI | InChI=1S/C28H44N4O3/c1-26-11-12-28(34,17-35-3)14-18(26)4-5-19-20-6-7-22(27(20,2)10-8-21(19)26)25(33)16-31-24-15-30-13-9-23(24)32-29/h9,13,15,18-22,31,34H,4-8,10-12,14,16-17,29H2,1-3H3,(H,30,32) |
| InChIKey | AVUKVZYRIQUCHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|