About 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate
5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate (PubChem CID 163437609) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate.
Molecular Properties
| Compound Name | 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate |
| PubChem CID | 163437609 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate |
| SMILES | CCC(=O)S(=O)OC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C11H18O4S/c1-2-10(12)16(13)15-9-4-7-14-11(8-9)5-3-6-11/h9H,2-8H2,1H3 |
| InChIKey | AVUXPRRXRZXOQZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate?
The IUPAC name of 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate (CID 163437609) is 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate.
What is the SMILES notation for 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate?
The canonical SMILES for 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate is CCC(=O)S(=O)OC1CCOC2(CCC2)C1.
What is the InChIKey of 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate?
The InChIKey is AVUXPRRXRZXOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c1-2-10(12)16(13)15-9-4-7-14-11(8-9)5-3-6-11/h9H,2-8H2,1H3.
What are the key properties of 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate?
5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate has a molecular weight of 246.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxaspiro[3.5]nonan-8-yl 1-oxopropane-1-sulfinate is sourced from PubChem (CID 163437609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).