About CID 163437713
CID 163437713 (PubChem CID 163437713) has the molecular formula C6H4AlN3
and a molecular weight of 145.10 g/mol.
Molecular Properties
| Compound Name | CID 163437713 |
| PubChem CID | 163437713 |
| Molecular Formula | C6H4AlN3 |
| Molecular Weight | 145.10 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | — |
| SMILES | [Al]c1[nH]nc2ccncc12 |
| InChI | InChI=1S/C6H4N3.Al/c1-2-7-3-5-4-8-9-6(1)5;/h1-3H,(H,8,9); |
| InChIKey | KOOQEDIGGHZCQB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.10 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 163437713 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163437713?
The IUPAC name of CID 163437713 (CID 163437713) is not available.
What is the SMILES notation for CID 163437713?
The canonical SMILES for CID 163437713 is [Al]c1[nH]nc2ccncc12.
What is the InChIKey of CID 163437713?
The InChIKey is KOOQEDIGGHZCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.Al/c1-2-7-3-5-4-8-9-6(1)5;/h1-3H,(H,8,9);.
What are the key properties of CID 163437713?
CID 163437713 has a molecular weight of 145.10 g/mol, XLogP of -0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163437713 is sourced from PubChem (CID 163437713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).