C15H20INO — CID 163437725
1-[2-(6-ethyl-4-iodo-2,5-dimethylcyclohexa-2,4-dien-1-yl)cyclopropyl]-2-iminoethanone (PubChem CID 163437725) has the molecular formula C15H20INO and a molecular weight of 357.24 g/mol. Its IUPAC name is 1-[2-(6-ethyl-4-iodo-2,5-dimethylcyclohexa-2,4-dien-1-yl)cyclopropyl]-2-iminoethanone.
| Compound Name | 1-[2-(6-ethyl-4-iodo-2,5-dimethylcyclohexa-2,4-dien-1-yl)cyclopropyl]-2-iminoethanone |
|---|---|
| PubChem CID | 163437725 |
| Molecular Formula | C15H20INO |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-[2-(6-ethyl-4-iodo-2,5-dimethylcyclohexa-2,4-dien-1-yl)cyclopropyl]-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)C1CC1C1C(C)=CC(I)=C(C)C1CC |
| InChI | InChI=1S/C15H20INO/c1-4-10-9(3)13(16)5-8(2)15(10)12-6-11(12)14(18)7-17/h5,7,10-12,15,17H,4,6H2,1-3H3/b17-7+ |
| InChIKey | AVXDYXMILNUKQZ-REZTVBANSA-N |
| XLogP | 4.15 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|