C14H17NS — CID 163438039
4a,8-dimethyl-4,5a,9a,10-tetrahydrophenothiazine (PubChem CID 163438039) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 4a,8-dimethyl-4,5a,9a,10-tetrahydrophenothiazine.
| Compound Name | 4a,8-dimethyl-4,5a,9a,10-tetrahydrophenothiazine |
|---|---|
| PubChem CID | 163438039 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4a,8-dimethyl-4,5a,9a,10-tetrahydrophenothiazine |
| SMILES | CC1=CC2NC3=CC=CCC3(C)SC2C=C1 |
| InChI | InChI=1S/C14H17NS/c1-10-6-7-12-11(9-10)15-13-5-3-4-8-14(13,2)16-12/h3-7,9,11-12,15H,8H2,1-2H3 |
| InChIKey | AWEIUXKLBGWREU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |