C16H16N4O2S — CID 163438596
3-amino-N-(5-methyl-1H-pyrazol-3-yl)-2-phenylbenzenesulfonamide (PubChem CID 163438596) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-amino-N-(5-methyl-1H-pyrazol-3-yl)-2-phenylbenzenesulfonamide.
| Compound Name | 3-amino-N-(5-methyl-1H-pyrazol-3-yl)-2-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 163438596 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-amino-N-(5-methyl-1H-pyrazol-3-yl)-2-phenylbenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccc(N)c2-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11-10-15(19-18-11)20-23(21,22)14-9-5-8-13(17)16(14)12-6-3-2-4-7-12/h2-10H,17H2,1H3,(H2,18,19,20) |
| InChIKey | AWPWJXHLTSLGNR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|