About 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde
8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde (PubChem CID 163439736) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde.
Molecular Properties
| Compound Name | 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde |
| PubChem CID | 163439736 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde |
| SMILES | CC1C=Cc2oc3c(C=O)cccc3c2C1 |
| InChI | InChI=1S/C14H12O2/c1-9-5-6-13-12(7-9)11-4-2-3-10(8-15)14(11)16-13/h2-6,8-9H,7H2,1H3 |
| InChIKey | AXMURBXJCRJYOL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde?
The IUPAC name of 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde (CID 163439736) is 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde.
What is the SMILES notation for 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde?
The canonical SMILES for 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde is CC1C=Cc2oc3c(C=O)cccc3c2C1.
What is the InChIKey of 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde?
The InChIKey is AXMURBXJCRJYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c1-9-5-6-13-12(7-9)11-4-2-3-10(8-15)14(11)16-13/h2-6,8-9H,7H2,1H3.
What are the key properties of 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde?
8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde has a molecular weight of 212.25 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8,9-dihydrodibenzofuran-4-carbaldehyde is sourced from PubChem (CID 163439736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).