About CID 163439801
CID 163439801 (PubChem CID 163439801) has the molecular formula C9H13N3SXe
and a molecular weight of 326.58 g/mol.
Molecular Properties
| Compound Name | CID 163439801 |
| PubChem CID | 163439801 |
| Molecular Formula | C9H13N3SXe |
| Molecular Weight | 326.58 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=c2ncnc(N)c2=[XeH]S1 |
| InChI | InChI=1S/C9H13N3SXe/c1-9(2,3)7-5-6(14-13-7)8(10)12-4-11-5/h4,14H,1-3H3,(H2,10,11,12) |
| InChIKey | AXOBLAPDZPGBAD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.58 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 163439801 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163439801?
The IUPAC name of CID 163439801 (CID 163439801) is not available.
What is the SMILES notation for CID 163439801?
The canonical SMILES for CID 163439801 is CC(C)(C)C1=c2ncnc(N)c2=[XeH]S1.
What is the InChIKey of CID 163439801?
The InChIKey is AXOBLAPDZPGBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3SXe/c1-9(2,3)7-5-6(14-13-7)8(10)12-4-11-5/h4,14H,1-3H3,(H2,10,11,12).
What are the key properties of CID 163439801?
CID 163439801 has a molecular weight of 326.58 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163439801 is sourced from PubChem (CID 163439801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).