C17H14F5N — CID 163440322
N-methyl-2-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]ethanamine (PubChem CID 163440322) has the molecular formula C17H14F5N and a molecular weight of 327.30 g/mol. Its IUPAC name is N-methyl-2-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]ethanamine.
| Compound Name | N-methyl-2-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 163440322 |
| Molecular Formula | C17H14F5N |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-methyl-2-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]ethanamine |
| SMILES | CNCCc1ccc(/C=C/c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F5N/c1-23-9-8-11-4-2-10(3-5-11)6-7-12-13(18)15(20)17(22)16(21)14(12)19/h2-7,23H,8-9H2,1H3/b7-6+ |
| InChIKey | AXZGHASCZFFFCP-VOTSOKGWSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|