C22H22IN2O3- — CID 163440617
CID 163440617 (PubChem CID 163440617) has the molecular formula C22H22IN2O3- and a molecular weight of 489.33 g/mol.
| Compound Name | CID 163440617 |
|---|---|
| PubChem CID | 163440617 |
| Molecular Formula | C22H22IN2O3- |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | — |
| SMILES | Cc1oc(-c2ccc(-c3ccc4c(c3)O[I-]O4)cc2)nc1CCN1CCCC1 |
| InChI | InChI=1S/C22H22IN2O3/c1-15-19(10-13-25-11-2-3-12-25)24-22(26-15)17-6-4-16(5-7-17)18-8-9-20-21(14-18)28-23-27-20/h4-9,14H,2-3,10-13H2,1H3/q-1 |
| InChIKey | MBDLHADSHKUCMQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|