About 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate
1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate (PubChem CID 163441031) has the molecular formula C15H28NO4+
and a molecular weight of 286.39 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate |
| PubChem CID | 163441031 |
| Molecular Formula | C15H28NO4+ |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(CC)CC[N+](C)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28NO4/c1-7-15(12(17)19-8-2)9-10-16(6,11-15)13(18)20-14(3,4)5/h7-11H2,1-6H3/q+1 |
| InChIKey | MTSBFYZCUYBEBW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate (CID 163441031) is 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate is CCOC(=O)C1(CC)CC[N+](C)(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate?
The InChIKey is MTSBFYZCUYBEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28NO4/c1-7-15(12(17)19-8-2)9-10-16(6,11-15)13(18)20-14(3,4)5/h7-11H2,1-6H3/q+1.
What are the key properties of 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate?
1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate has a molecular weight of 286.39 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-ethyl 3-ethyl-1-methylpyrrolidin-1-ium-1,3-dicarboxylate is sourced from PubChem (CID 163441031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).