About 5H-chromene-2,8-diol
5H-chromene-2,8-diol (PubChem CID 163441507) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5H-chromene-2,8-diol.
Molecular Properties
| Compound Name | 5H-chromene-2,8-diol |
| PubChem CID | 163441507 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 5H-chromene-2,8-diol |
| SMILES | OC1=CC=C2CC=CC(O)=C2O1 |
| InChI | InChI=1S/C9H8O3/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1,3-5,10-11H,2H2 |
| InChIKey | ZZMUINXGBCJWTF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-chromene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-chromene-2,8-diol?
The IUPAC name of 5H-chromene-2,8-diol (CID 163441507) is 5H-chromene-2,8-diol.
What is the SMILES notation for 5H-chromene-2,8-diol?
The canonical SMILES for 5H-chromene-2,8-diol is OC1=CC=C2CC=CC(O)=C2O1.
What is the InChIKey of 5H-chromene-2,8-diol?
The InChIKey is ZZMUINXGBCJWTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1,3-5,10-11H,2H2.
What are the key properties of 5H-chromene-2,8-diol?
5H-chromene-2,8-diol has a molecular weight of 164.16 g/mol, XLogP of 2.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-chromene-2,8-diol is sourced from PubChem (CID 163441507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).