About tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate
tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate (PubChem CID 163441730) has the molecular formula C19H28NO4-
and a molecular weight of 334.44 g/mol. Its IUPAC name is tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate |
| PubChem CID | 163441730 |
| Molecular Formula | C19H28NO4- |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)CCON([O-])C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C19H28NO4/c1-19(2,3)24-16(21)6-7-23-20(22)15-10-13-9-14(15)18-12-5-4-11(8-12)17(13)18/h4-5,11-15,17-18H,6-10H2,1-3H3/q-1 |
| InChIKey | HRXMGMUIFGYFKX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate?
The IUPAC name of tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate (CID 163441730) is tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate.
What is the SMILES notation for tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate?
The canonical SMILES for tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate is CC(C)(C)OC(=O)CCON([O-])C1CC2CC1C1C3C=CC(C3)C21.
What is the InChIKey of tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate?
The InChIKey is HRXMGMUIFGYFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28NO4/c1-19(2,3)24-16(21)6-7-23-20(22)15-10-13-9-14(15)18-12-5-4-11(8-12)17(13)18/h4-5,11-15,17-18H,6-10H2,1-3H3/q-1.
What are the key properties of tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate?
tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate has a molecular weight of 334.44 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[oxido(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)amino]oxypropanoate is sourced from PubChem (CID 163441730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).