About (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate
(6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate (PubChem CID 163441852) has the molecular formula C19H18BrF3O3S
and a molecular weight of 463.32 g/mol. Its IUPAC name is (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate |
| PubChem CID | 163441852 |
| Molecular Formula | C19H18BrF3O3S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)CC(C)(c2ccccc2)c2cc(Br)c(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H18BrF3O3S/c1-17(2)11-18(3,12-7-5-4-6-8-12)14-9-15(20)16(10-13(14)17)26-27(24,25)19(21,22)23/h4-10H,11H2,1-3H3 |
| InChIKey | AZFXGWLBELZGKF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate?
The IUPAC name of (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate (CID 163441852) is (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate is CC1(C)CC(C)(c2ccccc2)c2cc(Br)c(OS(=O)(=O)C(F)(F)F)cc21.
What is the InChIKey of (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate?
The InChIKey is AZFXGWLBELZGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrF3O3S/c1-17(2)11-18(3,12-7-5-4-6-8-12)14-9-15(20)16(10-13(14)17)26-27(24,25)19(21,22)23/h4-10H,11H2,1-3H3.
What are the key properties of (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate?
(6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate has a molecular weight of 463.32 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1,3,3-trimethyl-1-phenyl-2H-inden-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 163441852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).