About N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine
N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine (PubChem CID 163441879) has the molecular formula C9H15ClN2
and a molecular weight of 186.69 g/mol. Its IUPAC name is N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 163441879 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCC1C=C(Cl)C=CC1 |
| InChI | InChI=1S/C9H15ClN2/c10-9-3-1-2-8(6-9)7-12-5-4-11/h1,3,6,8,12H,2,4-5,7,11H2 |
| InChIKey | AZGHYDOTOSHODX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine (CID 163441879) is N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine is NCCNCC1C=C(Cl)C=CC1.
What is the InChIKey of N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine?
The InChIKey is AZGHYDOTOSHODX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2/c10-9-3-1-2-8(6-9)7-12-5-4-11/h1,3,6,8,12H,2,4-5,7,11H2.
What are the key properties of N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine?
N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine has a molecular weight of 186.69 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-chlorocyclohexa-2,4-dien-1-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 163441879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).