C20H38N2O2S — CID 163441915
N-ethyl-2-(4-methylcyclohexyl)oxy-N-[(3-pentyl-1,3-thiazolidin-2-yl)methyl]acetamide (PubChem CID 163441915) has the molecular formula C20H38N2O2S and a molecular weight of 370.60 g/mol. Its IUPAC name is N-ethyl-2-(4-methylcyclohexyl)oxy-N-[(3-pentyl-1,3-thiazolidin-2-yl)methyl]acetamide.
| Compound Name | N-ethyl-2-(4-methylcyclohexyl)oxy-N-[(3-pentyl-1,3-thiazolidin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 163441915 |
| Molecular Formula | C20H38N2O2S |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | N-ethyl-2-(4-methylcyclohexyl)oxy-N-[(3-pentyl-1,3-thiazolidin-2-yl)methyl]acetamide |
| SMILES | CCCCCN1CCSC1CN(CC)C(=O)COC1CCC(C)CC1 |
| InChI | InChI=1S/C20H38N2O2S/c1-4-6-7-12-22-13-14-25-20(22)15-21(5-2)19(23)16-24-18-10-8-17(3)9-11-18/h17-18,20H,4-16H2,1-3H3 |
| InChIKey | AZGTXCVEZKHHIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|