About [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate
[4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate (PubChem CID 163442224) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate |
| PubChem CID | 163442224 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1=CC=C(C(=O)C2CC=CCC2)CC1 |
| InChI | InChI=1S/C15H19NO3/c1-16-15(18)19-13-9-7-12(8-10-13)14(17)11-5-3-2-4-6-11/h2-3,7,9,11H,4-6,8,10H2,1H3,(H,16,18) |
| InChIKey | AZMPGALIUUHNQK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate?
The IUPAC name of [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate (CID 163442224) is [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate.
What is the SMILES notation for [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate?
The canonical SMILES for [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate is CNC(=O)OC1=CC=C(C(=O)C2CC=CCC2)CC1.
What is the InChIKey of [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate?
The InChIKey is AZMPGALIUUHNQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-16-15(18)19-13-9-7-12(8-10-13)14(17)11-5-3-2-4-6-11/h2-3,7,9,11H,4-6,8,10H2,1H3,(H,16,18).
What are the key properties of [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate?
[4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate has a molecular weight of 261.32 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyclohex-3-ene-1-carbonyl)cyclohexa-1,3-dien-1-yl] N-methylcarbamate is sourced from PubChem (CID 163442224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).