C23H21F4N3O2 — CID 163442311
N-[(2Z,4E)-1,1,1-trifluoro-6-[5-fluoro-2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)phenoxy]-5-methylhexa-2,4-dien-2-yl]methanimine (PubChem CID 163442311) has the molecular formula C23H21F4N3O2 and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[(2Z,4E)-1,1,1-trifluoro-6-[5-fluoro-2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)phenoxy]-5-methylhexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2Z,4E)-1,1,1-trifluoro-6-[5-fluoro-2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)phenoxy]-5-methylhexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 163442311 |
| Molecular Formula | C23H21F4N3O2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(2Z,4E)-1,1,1-trifluoro-6-[5-fluoro-2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)phenoxy]-5-methylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)COc1cc(F)c(Cc2c[nH]c3ncccc23)cc1OC)C(F)(F)F |
| InChI | InChI=1S/C23H21F4N3O2/c1-14(6-7-21(28-2)23(25,26)27)13-32-20-11-18(24)15(10-19(20)31-3)9-16-12-30-22-17(16)5-4-8-29-22/h4-8,10-12H,2,9,13H2,1,3H3,(H,29,30)/b14-6+,21-7- |
| InChIKey | AZODENGLSXUDET-RPHGHFIUSA-N |
| XLogP | 5.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|