C18H17BrF3NO — CID 163443525
N-(4-bromo-3-fluorophenyl)-2-[(6R)-5,6-difluoro-1-methylcyclohexa-2,4-dien-1-yl]pent-4-enamide (PubChem CID 163443525) has the molecular formula C18H17BrF3NO and a molecular weight of 400.24 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2-[(6R)-5,6-difluoro-1-methylcyclohexa-2,4-dien-1-yl]pent-4-enamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2-[(6R)-5,6-difluoro-1-methylcyclohexa-2,4-dien-1-yl]pent-4-enamide |
|---|---|
| PubChem CID | 163443525 |
| Molecular Formula | C18H17BrF3NO |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2-[(6R)-5,6-difluoro-1-methylcyclohexa-2,4-dien-1-yl]pent-4-enamide |
| SMILES | C=CCC(C(=O)Nc1ccc(Br)c(F)c1)C1(C)C=CC=C(F)[C@@H]1F |
| InChI | InChI=1S/C18H17BrF3NO/c1-3-5-12(18(2)9-4-6-14(20)16(18)22)17(24)23-11-7-8-13(19)15(21)10-11/h3-4,6-10,12,16H,1,5H2,2H3,(H,23,24)/t12?,16-,18?/m0/s1 |
| InChIKey | BAOOOYWSPQKVHR-IBFVRDEOSA-N |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|