C23H24ClF3O2 — CID 163443976
1-[1-[3-chloro-5-(4-propan-2-ylphenyl)-4-(2,2,2-trifluoroethoxy)phenyl]cyclobutyl]ethenol (PubChem CID 163443976) has the molecular formula C23H24ClF3O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 1-[1-[3-chloro-5-(4-propan-2-ylphenyl)-4-(2,2,2-trifluoroethoxy)phenyl]cyclobutyl]ethenol.
| Compound Name | 1-[1-[3-chloro-5-(4-propan-2-ylphenyl)-4-(2,2,2-trifluoroethoxy)phenyl]cyclobutyl]ethenol |
|---|---|
| PubChem CID | 163443976 |
| Molecular Formula | C23H24ClF3O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[1-[3-chloro-5-(4-propan-2-ylphenyl)-4-(2,2,2-trifluoroethoxy)phenyl]cyclobutyl]ethenol |
| SMILES | C=C(O)C1(c2cc(Cl)c(OCC(F)(F)F)c(-c3ccc(C(C)C)cc3)c2)CCC1 |
| InChI | InChI=1S/C23H24ClF3O2/c1-14(2)16-5-7-17(8-6-16)19-11-18(22(15(3)28)9-4-10-22)12-20(24)21(19)29-13-23(25,26)27/h5-8,11-12,14,28H,3-4,9-10,13H2,1-2H3 |
| InChIKey | BAXYTMRYZSQEKS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|