C9H10NO2S- — CID 163444403
(3E,5Z,7Z)-3-(sulfinatoamino)cyclonona-1,3,5,7-tetraene (PubChem CID 163444403) has the molecular formula C9H10NO2S- and a molecular weight of 196.25 g/mol. Its IUPAC name is (3E,5Z,7Z)-3-(sulfinatoamino)cyclonona-1,3,5,7-tetraene.
| Compound Name | (3E,5Z,7Z)-3-(sulfinatoamino)cyclonona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 163444403 |
| Molecular Formula | C9H10NO2S- |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (3E,5Z,7Z)-3-(sulfinatoamino)cyclonona-1,3,5,7-tetraene |
| SMILES | O=S([O-])N/C1=C/C=C\C=C/CC=C1 |
| InChI | InChI=1S/C9H11NO2S/c11-13(12)10-9-7-5-3-1-2-4-6-8-9/h1-3,5-8,10H,4H2,(H,11,12)/p-1/b2-1-,5-3-,8-6?,9-7+ |
| InChIKey | GMSVQHLYNHESAQ-ONUJSTDASA-M |
| XLogP | 1.33 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|