About 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one
4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one (PubChem CID 163444689) has the molecular formula C21H24BrNO5
and a molecular weight of 450.33 g/mol. Its IUPAC name is 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one.
Molecular Properties
| Compound Name | 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one |
| PubChem CID | 163444689 |
| Molecular Formula | C21H24BrNO5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one |
| SMILES | CCN(CC)CCOc1ccc2c(=O)c3c(OC)cc(OC)c(Br)c3oc2c1 |
| InChI | InChI=1S/C21H24BrNO5/c1-5-23(6-2)9-10-27-13-7-8-14-15(11-13)28-21-18(20(14)24)16(25-3)12-17(26-4)19(21)22/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | BBMXFXJYELWGDA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one?
The IUPAC name of 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one (CID 163444689) is 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one.
What is the SMILES notation for 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one?
The canonical SMILES for 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one is CCN(CC)CCOc1ccc2c(=O)c3c(OC)cc(OC)c(Br)c3oc2c1.
What is the InChIKey of 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one?
The InChIKey is BBMXFXJYELWGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BrNO5/c1-5-23(6-2)9-10-27-13-7-8-14-15(11-13)28-21-18(20(14)24)16(25-3)12-17(26-4)19(21)22/h7-8,11-12H,5-6,9-10H2,1-4H3.
What are the key properties of 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one?
4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one has a molecular weight of 450.33 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-[2-(diethylamino)ethoxy]-1,3-dimethoxyxanthen-9-one is sourced from PubChem (CID 163444689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).