About 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran
1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran (PubChem CID 163445562) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran |
| PubChem CID | 163445562 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran |
| SMILES | CCCOC1OC(OC)c2ccccc21 |
| InChI | InChI=1S/C12H16O3/c1-3-8-14-12-10-7-5-4-6-9(10)11(13-2)15-12/h4-7,11-12H,3,8H2,1-2H3 |
| InChIKey | BCFIKQBUCZGWEO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran?
The IUPAC name of 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran (CID 163445562) is 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran?
The canonical SMILES for 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran is CCCOC1OC(OC)c2ccccc21.
What is the InChIKey of 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran?
The InChIKey is BCFIKQBUCZGWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-8-14-12-10-7-5-4-6-9(10)11(13-2)15-12/h4-7,11-12H,3,8H2,1-2H3.
What are the key properties of 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran?
1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran has a molecular weight of 208.26 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-propoxy-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 163445562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).