C11H23NO3 — CID 163445727
[(E,2S,3R)-5-amino-2,3-dimethylhept-4-enoxy]methoxymethanol (PubChem CID 163445727) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is [(E,2S,3R)-5-amino-2,3-dimethylhept-4-enoxy]methoxymethanol.
| Compound Name | [(E,2S,3R)-5-amino-2,3-dimethylhept-4-enoxy]methoxymethanol |
|---|---|
| PubChem CID | 163445727 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | [(E,2S,3R)-5-amino-2,3-dimethylhept-4-enoxy]methoxymethanol |
| SMILES | CC/C(N)=C\[C@@H](C)[C@H](C)COCOCO |
| InChI | InChI=1S/C11H23NO3/c1-4-11(12)5-9(2)10(3)6-14-8-15-7-13/h5,9-10,13H,4,6-8,12H2,1-3H3/b11-5+/t9-,10-/m1/s1 |
| InChIKey | BCIRMLIQBKVSKR-PULSAQFYSA-N |
| XLogP | 1.45 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|